C12H18O3 — CID 154068975
4-(2-bicyclo[2.2.1]hept-5-enylmethoxy)butanoic acid (PubChem CID 154068975) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 4-(2-bicyclo[2.2.1]hept-5-enylmethoxy)butanoic acid.
| Compound Name | 4-(2-bicyclo[2.2.1]hept-5-enylmethoxy)butanoic acid |
|---|---|
| PubChem CID | 154068975 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 4-(2-bicyclo[2.2.1]hept-5-enylmethoxy)butanoic acid |
| SMILES | O=C(O)CCCOCC1CC2C=CC1C2 |
| InChI | InChI=1S/C12H18O3/c13-12(14)2-1-5-15-8-11-7-9-3-4-10(11)6-9/h3-4,9-11H,1-2,5-8H2,(H,13,14) |
| InChIKey | SLZLVYFHAAXODJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|