C12H16O2 — CID 57210651
4-(2-bicyclo[2.2.1]hept-5-enyl)-2-methylbut-2-enoic acid (PubChem CID 57210651) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 4-(2-bicyclo[2.2.1]hept-5-enyl)-2-methylbut-2-enoic acid.
| Compound Name | 4-(2-bicyclo[2.2.1]hept-5-enyl)-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 57210651 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 4-(2-bicyclo[2.2.1]hept-5-enyl)-2-methylbut-2-enoic acid |
| SMILES | CC(=CCC1CC2C=CC1C2)C(=O)O |
| InChI | InChI=1S/C12H16O2/c1-8(12(13)14)2-4-10-6-9-3-5-11(10)7-9/h2-3,5,9-11H,4,6-7H2,1H3,(H,13,14) |
| InChIKey | DLLOXAZXPOUWIK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|