C8H11N3O2 — CID 121395327
N-methoxy-N,6-dimethylpyrimidine-4-carboxamide (PubChem CID 121395327) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is N-methoxy-N,6-dimethylpyrimidine-4-carboxamide.
| Compound Name | N-methoxy-N,6-dimethylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 121395327 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | N-methoxy-N,6-dimethylpyrimidine-4-carboxamide |
| SMILES | CON(C)C(=O)c1cc(C)ncn1 |
| InChI | InChI=1S/C8H11N3O2/c1-6-4-7(10-5-9-6)8(12)11(2)13-3/h4-5H,1-3H3 |
| InChIKey | RYLMGWHGFCMPRZ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|