C14H26N4O2 — CID 158794501
N,N-diethylethanamine;N-methoxy-N,5-dimethylpyrazine-2-carboxamide (PubChem CID 158794501) has the molecular formula C14H26N4O2 and a molecular weight of 282.39 g/mol. Its IUPAC name is N,N-diethylethanamine;N-methoxy-N,5-dimethylpyrazine-2-carboxamide.
| Compound Name | N,N-diethylethanamine;N-methoxy-N,5-dimethylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 158794501 |
| Molecular Formula | C14H26N4O2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | N,N-diethylethanamine;N-methoxy-N,5-dimethylpyrazine-2-carboxamide |
| SMILES | CCN(CC)CC.CON(C)C(=O)c1cnc(C)cn1 |
| InChI | InChI=1S/C8H11N3O2.C6H15N/c1-6-4-10-7(5-9-6)8(12)11(2)13-3;1-4-7(5-2)6-3/h4-5H,1-3H3;4-6H2,1-3H3 |
| InChIKey | ISRSUUUPKFBTHO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|