C9H14N4O — CID 62686428
N-(2-aminoethyl)-N,5-dimethylpyrazine-2-carboxamide (PubChem CID 62686428) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is N-(2-aminoethyl)-N,5-dimethylpyrazine-2-carboxamide.
| Compound Name | N-(2-aminoethyl)-N,5-dimethylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 62686428 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | N-(2-aminoethyl)-N,5-dimethylpyrazine-2-carboxamide |
| SMILES | Cc1cnc(C(=O)N(C)CCN)cn1 |
| InChI | InChI=1S/C9H14N4O/c1-7-5-12-8(6-11-7)9(14)13(2)4-3-10/h5-6H,3-4,10H2,1-2H3 |
| InChIKey | UAHIQFUCZZYZMU-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |