C19H24N4O — CID 24551928
N,5-dimethyl-N-[(4-piperidin-1-ylphenyl)methyl]pyrazine-2-carboxamide (PubChem CID 24551928) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is N,5-dimethyl-N-[(4-piperidin-1-ylphenyl)methyl]pyrazine-2-carboxamide.
| Compound Name | N,5-dimethyl-N-[(4-piperidin-1-ylphenyl)methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 24551928 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | N,5-dimethyl-N-[(4-piperidin-1-ylphenyl)methyl]pyrazine-2-carboxamide |
| SMILES | Cc1cnc(C(=O)N(C)Cc2ccc(N3CCCCC3)cc2)cn1 |
| InChI | InChI=1S/C19H24N4O/c1-15-12-21-18(13-20-15)19(24)22(2)14-16-6-8-17(9-7-16)23-10-4-3-5-11-23/h6-9,12-13H,3-5,10-11,14H2,1-2H3 |
| InChIKey | FLOPQENRGTUQNH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|