C23H30N2O4 — CID 24551923
3,4,5-trimethoxy-N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]benzamide (PubChem CID 24551923) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 24551923 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 3,4,5-trimethoxy-N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]benzamide |
| SMILES | COc1cc(C(=O)N(C)Cc2ccc(N3CCCCC3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C23H30N2O4/c1-24(16-17-8-10-19(11-9-17)25-12-6-5-7-13-25)23(26)18-14-20(27-2)22(29-4)21(15-18)28-3/h8-11,14-15H,5-7,12-13,16H2,1-4H3 |
| InChIKey | XEDAXQLCKYALTG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|