C22H24N4O3 — CID 25391675
N-methyl-1,4-dioxo-N-[(4-piperidin-1-ylphenyl)methyl]-2,3-dihydrophthalazine-6-carboxamide (PubChem CID 25391675) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is N-methyl-1,4-dioxo-N-[(4-piperidin-1-ylphenyl)methyl]-2,3-dihydrophthalazine-6-carboxamide.
| Compound Name | N-methyl-1,4-dioxo-N-[(4-piperidin-1-ylphenyl)methyl]-2,3-dihydrophthalazine-6-carboxamide |
|---|---|
| PubChem CID | 25391675 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | N-methyl-1,4-dioxo-N-[(4-piperidin-1-ylphenyl)methyl]-2,3-dihydrophthalazine-6-carboxamide |
| SMILES | CN(Cc1ccc(N2CCCCC2)cc1)C(=O)c1ccc2c(=O)[nH][nH]c(=O)c2c1 |
| InChI | InChI=1S/C22H24N4O3/c1-25(14-15-5-8-17(9-6-15)26-11-3-2-4-12-26)22(29)16-7-10-18-19(13-16)21(28)24-23-20(18)27/h5-10,13H,2-4,11-12,14H2,1H3,(H,23,27)(H,24,28) |
| InChIKey | KMTKAUDFQGMQFJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|