C27H32N4O2 — CID 34470728
N-methyl-12-oxo-N-[(4-piperidin-1-ylphenyl)methyl]-7,8,9,10-tetrahydro-6H-azepino[2,1-b]quinazoline-3-carboxamide (PubChem CID 34470728) has the molecular formula C27H32N4O2 and a molecular weight of 444.58 g/mol. Its IUPAC name is N-methyl-12-oxo-N-[(4-piperidin-1-ylphenyl)methyl]-7,8,9,10-tetrahydro-6H-azepino[2,1-b]quinazoline-3-carboxamide.
| Compound Name | N-methyl-12-oxo-N-[(4-piperidin-1-ylphenyl)methyl]-7,8,9,10-tetrahydro-6H-azepino[2,1-b]quinazoline-3-carboxamide |
|---|---|
| PubChem CID | 34470728 |
| Molecular Formula | C27H32N4O2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | N-methyl-12-oxo-N-[(4-piperidin-1-ylphenyl)methyl]-7,8,9,10-tetrahydro-6H-azepino[2,1-b]quinazoline-3-carboxamide |
| SMILES | CN(Cc1ccc(N2CCCCC2)cc1)C(=O)c1ccc2c(=O)n3c(nc2c1)CCCCC3 |
| InChI | InChI=1S/C27H32N4O2/c1-29(19-20-9-12-22(13-10-20)30-15-5-3-6-16-30)26(32)21-11-14-23-24(18-21)28-25-8-4-2-7-17-31(25)27(23)33/h9-14,18H,2-8,15-17,19H2,1H3 |
| InChIKey | ROYVWVRIUCEZRM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|