C25H32N2O3 — CID 46662287
N-methyl-4-(oxolan-2-ylmethoxy)-N-[(4-piperidin-1-ylphenyl)methyl]benzamide (PubChem CID 46662287) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is N-methyl-4-(oxolan-2-ylmethoxy)-N-[(4-piperidin-1-ylphenyl)methyl]benzamide.
| Compound Name | N-methyl-4-(oxolan-2-ylmethoxy)-N-[(4-piperidin-1-ylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 46662287 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | N-methyl-4-(oxolan-2-ylmethoxy)-N-[(4-piperidin-1-ylphenyl)methyl]benzamide |
| SMILES | CN(Cc1ccc(N2CCCCC2)cc1)C(=O)c1ccc(OCC2CCCO2)cc1 |
| InChI | InChI=1S/C25H32N2O3/c1-26(18-20-7-11-22(12-8-20)27-15-3-2-4-16-27)25(28)21-9-13-23(14-10-21)30-19-24-6-5-17-29-24/h7-14,24H,2-6,15-19H2,1H3 |
| InChIKey | KKIHJFNSGRBCCM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|