C25H34N2O4 — CID 144603074
N-[1-(4-hydroxyphenyl)ethyl]acetamide;1-[4-(oxolan-2-ylmethoxy)phenyl]pyrrolidine (PubChem CID 144603074) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is N-[1-(4-hydroxyphenyl)ethyl]acetamide;1-[4-(oxolan-2-ylmethoxy)phenyl]pyrrolidine.
| Compound Name | N-[1-(4-hydroxyphenyl)ethyl]acetamide;1-[4-(oxolan-2-ylmethoxy)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 144603074 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | N-[1-(4-hydroxyphenyl)ethyl]acetamide;1-[4-(oxolan-2-ylmethoxy)phenyl]pyrrolidine |
| SMILES | CC(=O)NC(C)c1ccc(O)cc1.c1cc(N2CCCC2)ccc1OCC1CCCO1 |
| InChI | InChI=1S/C15H21NO2.C10H13NO2/c1-2-10-16(9-1)13-5-7-14(8-6-13)18-12-15-4-3-11-17-15;1-7(11-8(2)12)9-3-5-10(13)6-4-9/h5-8,15H,1-4,9-12H2;3-7,13H,1-2H3,(H,11,12) |
| InChIKey | TUCOLKOVHKRGRH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|