C6H8INO — CID 122594172
3-(1-iodoethyl)-5-methyl-1,2-oxazole (PubChem CID 122594172) has the molecular formula C6H8INO and a molecular weight of 237.04 g/mol. Its IUPAC name is 3-(1-iodoethyl)-5-methyl-1,2-oxazole.
| Compound Name | 3-(1-iodoethyl)-5-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 122594172 |
| Molecular Formula | C6H8INO |
| Molecular Weight | 237.04 g/mol |
| Exact Mass | 236.97 |
| IUPAC Name | 3-(1-iodoethyl)-5-methyl-1,2-oxazole |
| SMILES | Cc1cc(C(C)I)no1 |
| InChI | InChI=1S/C6H8INO/c1-4-3-6(5(2)7)8-9-4/h3,5H,1-2H3 |
| InChIKey | JLPCZQDIRUJWPT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.04 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|