C10H17NO — CID 166844258
5-methyl-3-(2-methylpentan-3-yl)-1,2-oxazole (PubChem CID 166844258) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 5-methyl-3-(2-methylpentan-3-yl)-1,2-oxazole.
| Compound Name | 5-methyl-3-(2-methylpentan-3-yl)-1,2-oxazole |
|---|---|
| PubChem CID | 166844258 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 5-methyl-3-(2-methylpentan-3-yl)-1,2-oxazole |
| SMILES | CCC(c1cc(C)on1)C(C)C |
| InChI | InChI=1S/C10H17NO/c1-5-9(7(2)3)10-6-8(4)12-11-10/h6-7,9H,5H2,1-4H3 |
| InChIKey | JZEOMBBWENOUIR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |