About N-[1-(5-methyl-1,2-oxazol-3-yl)ethyl]propan-2-amine
N-[1-(5-methyl-1,2-oxazol-3-yl)ethyl]propan-2-amine (PubChem CID 130891221) has the molecular formula C9H16N2O
and a molecular weight of 168.24 g/mol. Its IUPAC name is N-[1-(5-methyl-1,2-oxazol-3-yl)ethyl]propan-2-amine.
Analyze N-[1-(5-methyl-1,2-oxazol-3-yl)ethyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(5-methyl-1,2-oxazol-3-yl)ethyl]propan-2-amine?
The IUPAC name of N-[1-(5-methyl-1,2-oxazol-3-yl)ethyl]propan-2-amine (CID 130891221) is N-[1-(5-methyl-1,2-oxazol-3-yl)ethyl]propan-2-amine.
What is the SMILES notation for N-[1-(5-methyl-1,2-oxazol-3-yl)ethyl]propan-2-amine?
The canonical SMILES for N-[1-(5-methyl-1,2-oxazol-3-yl)ethyl]propan-2-amine is Cc1cc(C(C)NC(C)C)no1.
What is the InChIKey of N-[1-(5-methyl-1,2-oxazol-3-yl)ethyl]propan-2-amine?
The InChIKey is HONONZWFKFWQIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O/c1-6(2)10-8(4)9-5-7(3)12-11-9/h5-6,8,10H,1-4H3.
What are the key properties of N-[1-(5-methyl-1,2-oxazol-3-yl)ethyl]propan-2-amine?
N-[1-(5-methyl-1,2-oxazol-3-yl)ethyl]propan-2-amine has a molecular weight of 168.24 g/mol, XLogP of 2.04, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(5-methyl-1,2-oxazol-3-yl)ethyl]propan-2-amine is sourced from PubChem (CID 130891221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).