About N-[(1R)-1-(5-methyl-1,2-oxazol-3-yl)ethyl]methanesulfonamide
N-[(1R)-1-(5-methyl-1,2-oxazol-3-yl)ethyl]methanesulfonamide (PubChem CID 126987427) has the molecular formula C7H12N2O3S
and a molecular weight of 204.25 g/mol. Its IUPAC name is N-[(1R)-1-(5-methyl-1,2-oxazol-3-yl)ethyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[(1R)-1-(5-methyl-1,2-oxazol-3-yl)ethyl]methanesulfonamide |
| PubChem CID | 126987427 |
| Molecular Formula | C7H12N2O3S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | N-[(1R)-1-(5-methyl-1,2-oxazol-3-yl)ethyl]methanesulfonamide |
| SMILES | Cc1cc([C@@H](C)NS(C)(=O)=O)no1 |
| InChI | InChI=1S/C7H12N2O3S/c1-5-4-7(8-12-5)6(2)9-13(3,10)11/h4,6,9H,1-3H3/t6-/m1/s1 |
| InChIKey | BQTMCOFORPIVNI-ZCFIWIBFSA-N |
| XLogP | 0.59 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(1R)-1-(5-methyl-1,2-oxazol-3-yl)ethyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R)-1-(5-methyl-1,2-oxazol-3-yl)ethyl]methanesulfonamide?
The IUPAC name of N-[(1R)-1-(5-methyl-1,2-oxazol-3-yl)ethyl]methanesulfonamide (CID 126987427) is N-[(1R)-1-(5-methyl-1,2-oxazol-3-yl)ethyl]methanesulfonamide.
What is the SMILES notation for N-[(1R)-1-(5-methyl-1,2-oxazol-3-yl)ethyl]methanesulfonamide?
The canonical SMILES for N-[(1R)-1-(5-methyl-1,2-oxazol-3-yl)ethyl]methanesulfonamide is Cc1cc([C@@H](C)NS(C)(=O)=O)no1.
What is the InChIKey of N-[(1R)-1-(5-methyl-1,2-oxazol-3-yl)ethyl]methanesulfonamide?
The InChIKey is BQTMCOFORPIVNI-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H12N2O3S/c1-5-4-7(8-12-5)6(2)9-13(3,10)11/h4,6,9H,1-3H3/t6-/m1/s1.
What are the key properties of N-[(1R)-1-(5-methyl-1,2-oxazol-3-yl)ethyl]methanesulfonamide?
N-[(1R)-1-(5-methyl-1,2-oxazol-3-yl)ethyl]methanesulfonamide has a molecular weight of 204.25 g/mol, XLogP of 0.59, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R)-1-(5-methyl-1,2-oxazol-3-yl)ethyl]methanesulfonamide is sourced from PubChem (CID 126987427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).