C11H17NO2 — CID 83830998
5-methyl-3-(5-methyl-1,2-oxazol-3-yl)hexanal (PubChem CID 83830998) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 5-methyl-3-(5-methyl-1,2-oxazol-3-yl)hexanal.
| Compound Name | 5-methyl-3-(5-methyl-1,2-oxazol-3-yl)hexanal |
|---|---|
| PubChem CID | 83830998 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 5-methyl-3-(5-methyl-1,2-oxazol-3-yl)hexanal |
| SMILES | Cc1cc(C(CC=O)CC(C)C)no1 |
| InChI | InChI=1S/C11H17NO2/c1-8(2)6-10(4-5-13)11-7-9(3)14-12-11/h5,7-8,10H,4,6H2,1-3H3 |
| InChIKey | SXOBSQXJFUCXQS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|