C6H10N2O2 — CID 82417979
2-amino-2-(5-methyl-1,2-oxazol-3-yl)ethanol (PubChem CID 82417979) has the molecular formula C6H10N2O2 and a molecular weight of 142.16 g/mol. Its IUPAC name is 2-amino-2-(5-methyl-1,2-oxazol-3-yl)ethanol.
| Compound Name | 2-amino-2-(5-methyl-1,2-oxazol-3-yl)ethanol |
|---|---|
| PubChem CID | 82417979 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | 2-amino-2-(5-methyl-1,2-oxazol-3-yl)ethanol |
| SMILES | Cc1cc(C(N)CO)no1 |
| InChI | InChI=1S/C6H10N2O2/c1-4-2-6(8-10-4)5(7)3-9/h2,5,9H,3,7H2,1H3 |
| InChIKey | XXOGELVKKYYUGW-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |