C7H12N2O2 — CID 83826495
2-amino-2-(5-ethyl-1,2-oxazol-3-yl)ethanol (PubChem CID 83826495) has the molecular formula C7H12N2O2 and a molecular weight of 156.18 g/mol. Its IUPAC name is 2-amino-2-(5-ethyl-1,2-oxazol-3-yl)ethanol.
| Compound Name | 2-amino-2-(5-ethyl-1,2-oxazol-3-yl)ethanol |
|---|---|
| PubChem CID | 83826495 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 2-amino-2-(5-ethyl-1,2-oxazol-3-yl)ethanol |
| SMILES | CCc1cc(C(N)CO)no1 |
| InChI | InChI=1S/C7H12N2O2/c1-2-5-3-7(9-11-5)6(8)4-10/h3,6,10H,2,4,8H2,1H3 |
| InChIKey | NJPXWHQWIKRPCR-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |