C10H16N2O3 — CID 112716587
2-amino-4-methyl-3-(5-methyl-1,2-oxazol-3-yl)pentanoic acid (PubChem CID 112716587) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-amino-4-methyl-3-(5-methyl-1,2-oxazol-3-yl)pentanoic acid.
| Compound Name | 2-amino-4-methyl-3-(5-methyl-1,2-oxazol-3-yl)pentanoic acid |
|---|---|
| PubChem CID | 112716587 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 2-amino-4-methyl-3-(5-methyl-1,2-oxazol-3-yl)pentanoic acid |
| SMILES | Cc1cc(C(C(C)C)C(N)C(=O)O)no1 |
| InChI | InChI=1S/C10H16N2O3/c1-5(2)8(9(11)10(13)14)7-4-6(3)15-12-7/h4-5,8-9H,11H2,1-3H3,(H,13,14) |
| InChIKey | LKWVNPQCFSITRG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |