C6H8N2O3 — CID 67395403
3-(1-aminoethyl)-1,2-oxazole-5-carboxylic acid (PubChem CID 67395403) has the molecular formula C6H8N2O3 and a molecular weight of 156.14 g/mol. Its IUPAC name is 3-(1-aminoethyl)-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-(1-aminoethyl)-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 67395403 |
| Molecular Formula | C6H8N2O3 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 3-(1-aminoethyl)-1,2-oxazole-5-carboxylic acid |
| SMILES | CC(N)c1cc(C(=O)O)on1 |
| InChI | InChI=1S/C6H8N2O3/c1-3(7)4-2-5(6(9)10)11-8-4/h2-3H,7H2,1H3,(H,9,10) |
| InChIKey | VJLVGQWHWSTVQT-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |