About N,N-dimethyl-3-propan-2-yl-1,2-oxazole-5-carboxamide
N,N-dimethyl-3-propan-2-yl-1,2-oxazole-5-carboxamide (PubChem CID 130669877) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is N,N-dimethyl-3-propan-2-yl-1,2-oxazole-5-carboxamide.
Analyze N,N-dimethyl-3-propan-2-yl-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-3-propan-2-yl-1,2-oxazole-5-carboxamide?
The IUPAC name of N,N-dimethyl-3-propan-2-yl-1,2-oxazole-5-carboxamide (CID 130669877) is N,N-dimethyl-3-propan-2-yl-1,2-oxazole-5-carboxamide.
What is the SMILES notation for N,N-dimethyl-3-propan-2-yl-1,2-oxazole-5-carboxamide?
The canonical SMILES for N,N-dimethyl-3-propan-2-yl-1,2-oxazole-5-carboxamide is CC(C)c1cc(C(=O)N(C)C)on1.
What is the InChIKey of N,N-dimethyl-3-propan-2-yl-1,2-oxazole-5-carboxamide?
The InChIKey is IFZIRJTYRKLTDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c1-6(2)7-5-8(13-10-7)9(12)11(3)4/h5-6H,1-4H3.
What are the key properties of N,N-dimethyl-3-propan-2-yl-1,2-oxazole-5-carboxamide?
N,N-dimethyl-3-propan-2-yl-1,2-oxazole-5-carboxamide has a molecular weight of 182.22 g/mol, XLogP of 1.50, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-3-propan-2-yl-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 130669877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).