C9H11NO2 — CID 83826800
2-cyclopropyl-2-(5-methyl-1,2-oxazol-3-yl)acetaldehyde (PubChem CID 83826800) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 2-cyclopropyl-2-(5-methyl-1,2-oxazol-3-yl)acetaldehyde.
| Compound Name | 2-cyclopropyl-2-(5-methyl-1,2-oxazol-3-yl)acetaldehyde |
|---|---|
| PubChem CID | 83826800 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 2-cyclopropyl-2-(5-methyl-1,2-oxazol-3-yl)acetaldehyde |
| SMILES | Cc1cc(C(C=O)C2CC2)no1 |
| InChI | InChI=1S/C9H11NO2/c1-6-4-9(10-12-6)8(5-11)7-2-3-7/h4-5,7-8H,2-3H2,1H3 |
| InChIKey | HYTGIJJZZOXVHZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|