C12H17NO2 — CID 83833821
3-cyclopropyl-3-(5-propan-2-yl-1,2-oxazol-3-yl)propanal (PubChem CID 83833821) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 3-cyclopropyl-3-(5-propan-2-yl-1,2-oxazol-3-yl)propanal.
| Compound Name | 3-cyclopropyl-3-(5-propan-2-yl-1,2-oxazol-3-yl)propanal |
|---|---|
| PubChem CID | 83833821 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 3-cyclopropyl-3-(5-propan-2-yl-1,2-oxazol-3-yl)propanal |
| SMILES | CC(C)c1cc(C(CC=O)C2CC2)no1 |
| InChI | InChI=1S/C12H17NO2/c1-8(2)12-7-11(13-15-12)10(5-6-14)9-3-4-9/h6-10H,3-5H2,1-2H3 |
| InChIKey | ZPDMVKVAIQXIOC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|