C15H25NO3 — CID 169492381
4-[5-(6-methylheptyl)-1,2-oxazol-3-yl]butanoic acid (PubChem CID 169492381) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is 4-[5-(6-methylheptyl)-1,2-oxazol-3-yl]butanoic acid.
| Compound Name | 4-[5-(6-methylheptyl)-1,2-oxazol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 169492381 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 4-[5-(6-methylheptyl)-1,2-oxazol-3-yl]butanoic acid |
| SMILES | CC(C)CCCCCc1cc(CCCC(=O)O)no1 |
| InChI | InChI=1S/C15H25NO3/c1-12(2)7-4-3-5-9-14-11-13(16-19-14)8-6-10-15(17)18/h11-12H,3-10H2,1-2H3,(H,17,18) |
| InChIKey | GJAICKRRAVERNT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|