C8H11NO3 — CID 82597890
2-(3-methyl-1,2-oxazol-5-yl)butanoic acid (PubChem CID 82597890) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is 2-(3-methyl-1,2-oxazol-5-yl)butanoic acid.
| Compound Name | 2-(3-methyl-1,2-oxazol-5-yl)butanoic acid |
|---|---|
| PubChem CID | 82597890 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 2-(3-methyl-1,2-oxazol-5-yl)butanoic acid |
| SMILES | CCC(C(=O)O)c1cc(C)no1 |
| InChI | InChI=1S/C8H11NO3/c1-3-6(8(10)11)7-4-5(2)9-12-7/h4,6H,3H2,1-2H3,(H,10,11) |
| InChIKey | JNYOCSKSPFZSSN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |