2-(3-methyl-1,2-oxazol-5-yl)acetic acid

C6H7NO3 — CID 4195532

IUPAC2-(3-methyl-1,2-oxazol-5-yl)acetic acid
SMILESCc1cc(CC(=O)O)on1
InChIInChI=1S/C6H7NO3/c1-4-2-5(10-7-4)3-6(8)9/h2H,3H2,1H3,(H,8,9)
InChIKeyPOEFJFLAFQWOTL-UHFFFAOYSA-N
MW141.13 g/mol
LogP0.61
Rot. Bonds2

About 2-(3-methyl-1,2-oxazol-5-yl)acetic acid

2-(3-methyl-1,2-oxazol-5-yl)acetic acid (PubChem CID 4195532) has the molecular formula C6H7NO3 and a molecular weight of 141.13 g/mol. Its IUPAC name is 2-(3-methyl-1,2-oxazol-5-yl)acetic acid.

Molecular Properties

Compound Name2-(3-methyl-1,2-oxazol-5-yl)acetic acid
PubChem CID4195532
Molecular FormulaC6H7NO3
Molecular Weight141.13 g/mol
Exact Mass141.04
IUPAC Name2-(3-methyl-1,2-oxazol-5-yl)acetic acid
SMILESCc1cc(CC(=O)O)on1
InChIInChI=1S/C6H7NO3/c1-4-2-5(10-7-4)3-6(8)9/h2H,3H2,1H3,(H,8,9)
InChIKeyPOEFJFLAFQWOTL-UHFFFAOYSA-N
XLogP0.61
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500141.13
LogP ≤ 50.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(3-methyl-1,2-oxazol-5-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-methyl-1,2-oxazol-5-yl)acetic acid?
The IUPAC name of 2-(3-methyl-1,2-oxazol-5-yl)acetic acid (CID 4195532) is 2-(3-methyl-1,2-oxazol-5-yl)acetic acid.
What is the SMILES notation for 2-(3-methyl-1,2-oxazol-5-yl)acetic acid?
The canonical SMILES for 2-(3-methyl-1,2-oxazol-5-yl)acetic acid is Cc1cc(CC(=O)O)on1.
What is the InChIKey of 2-(3-methyl-1,2-oxazol-5-yl)acetic acid?
The InChIKey is POEFJFLAFQWOTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO3/c1-4-2-5(10-7-4)3-6(8)9/h2H,3H2,1H3,(H,8,9).
What are the key properties of 2-(3-methyl-1,2-oxazol-5-yl)acetic acid?
2-(3-methyl-1,2-oxazol-5-yl)acetic acid has a molecular weight of 141.13 g/mol, XLogP of 0.61, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methyl-1,2-oxazol-5-yl)acetic acid is sourced from PubChem (CID 4195532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).