C6H7NO3 — CID 4195532
2-(3-methyl-1,2-oxazol-5-yl)acetic acid (PubChem CID 4195532) has the molecular formula C6H7NO3 and a molecular weight of 141.13 g/mol. Its IUPAC name is 2-(3-methyl-1,2-oxazol-5-yl)acetic acid.
| Compound Name | 2-(3-methyl-1,2-oxazol-5-yl)acetic acid |
|---|---|
| PubChem CID | 4195532 |
| Molecular Formula | C6H7NO3 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.04 |
| IUPAC Name | 2-(3-methyl-1,2-oxazol-5-yl)acetic acid |
| SMILES | Cc1cc(CC(=O)O)on1 |
| InChI | InChI=1S/C6H7NO3/c1-4-2-5(10-7-4)3-6(8)9/h2H,3H2,1H3,(H,8,9) |
| InChIKey | POEFJFLAFQWOTL-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |