5-(2-hydroxyethyl)-1,2-oxazole-3-carboxylic acid

C6H7NO4 — CID 67169806

IUPAC5-(2-hydroxyethyl)-1,2-oxazole-3-carboxylic acid
SMILESO=C(O)c1cc(CCO)on1
InChIInChI=1S/C6H7NO4/c8-2-1-4-3-5(6(9)10)7-11-4/h3,8H,1-2H2,(H,9,10)
InChIKeyAGUHXUDCDCOTFM-UHFFFAOYSA-N
MW157.12 g/mol
LogP-0.09
Rot. Bonds3

About 5-(2-hydroxyethyl)-1,2-oxazole-3-carboxylic acid

5-(2-hydroxyethyl)-1,2-oxazole-3-carboxylic acid (PubChem CID 67169806) has the molecular formula C6H7NO4 and a molecular weight of 157.12 g/mol. Its IUPAC name is 5-(2-hydroxyethyl)-1,2-oxazole-3-carboxylic acid.

Molecular Properties

Compound Name5-(2-hydroxyethyl)-1,2-oxazole-3-carboxylic acid
PubChem CID67169806
Molecular FormulaC6H7NO4
Molecular Weight157.12 g/mol
Exact Mass157.04
IUPAC Name5-(2-hydroxyethyl)-1,2-oxazole-3-carboxylic acid
SMILESO=C(O)c1cc(CCO)on1
InChIInChI=1S/C6H7NO4/c8-2-1-4-3-5(6(9)10)7-11-4/h3,8H,1-2H2,(H,9,10)
InChIKeyAGUHXUDCDCOTFM-UHFFFAOYSA-N
XLogP-0.09
TPSA83.56 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500157.12
LogP ≤ 5-0.09
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 5-(2-hydroxyethyl)-1,2-oxazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2-hydroxyethyl)-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-(2-hydroxyethyl)-1,2-oxazole-3-carboxylic acid (CID 67169806) is 5-(2-hydroxyethyl)-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-(2-hydroxyethyl)-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-(2-hydroxyethyl)-1,2-oxazole-3-carboxylic acid is O=C(O)c1cc(CCO)on1.
What is the InChIKey of 5-(2-hydroxyethyl)-1,2-oxazole-3-carboxylic acid?
The InChIKey is AGUHXUDCDCOTFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO4/c8-2-1-4-3-5(6(9)10)7-11-4/h3,8H,1-2H2,(H,9,10).
What are the key properties of 5-(2-hydroxyethyl)-1,2-oxazole-3-carboxylic acid?
5-(2-hydroxyethyl)-1,2-oxazole-3-carboxylic acid has a molecular weight of 157.12 g/mol, XLogP of -0.09, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-hydroxyethyl)-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 67169806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).