About 3-cyclobutyl-1,2-oxazole-5-carbaldehyde
3-cyclobutyl-1,2-oxazole-5-carbaldehyde (PubChem CID 14366567) has the molecular formula C8H9NO2
and a molecular weight of 151.17 g/mol. Its IUPAC name is 3-cyclobutyl-1,2-oxazole-5-carbaldehyde.
Molecular Properties
| Compound Name | 3-cyclobutyl-1,2-oxazole-5-carbaldehyde |
| PubChem CID | 14366567 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 3-cyclobutyl-1,2-oxazole-5-carbaldehyde |
| SMILES | O=Cc1cc(C2CCC2)no1 |
| InChI | InChI=1S/C8H9NO2/c10-5-7-4-8(9-11-7)6-2-1-3-6/h4-6H,1-3H2 |
| InChIKey | QYGRFWYIAYZBFX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclobutyl-1,2-oxazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclobutyl-1,2-oxazole-5-carbaldehyde?
The IUPAC name of 3-cyclobutyl-1,2-oxazole-5-carbaldehyde (CID 14366567) is 3-cyclobutyl-1,2-oxazole-5-carbaldehyde.
What is the SMILES notation for 3-cyclobutyl-1,2-oxazole-5-carbaldehyde?
The canonical SMILES for 3-cyclobutyl-1,2-oxazole-5-carbaldehyde is O=Cc1cc(C2CCC2)no1.
What is the InChIKey of 3-cyclobutyl-1,2-oxazole-5-carbaldehyde?
The InChIKey is QYGRFWYIAYZBFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2/c10-5-7-4-8(9-11-7)6-2-1-3-6/h4-6H,1-3H2.
What are the key properties of 3-cyclobutyl-1,2-oxazole-5-carbaldehyde?
3-cyclobutyl-1,2-oxazole-5-carbaldehyde has a molecular weight of 151.17 g/mol, XLogP of 1.75, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclobutyl-1,2-oxazole-5-carbaldehyde is sourced from PubChem (CID 14366567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).