C9H16N2O — CID 91277135
5-methyl-3-(2-methylpentan-3-yl)-1,2,4-oxadiazole (PubChem CID 91277135) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 5-methyl-3-(2-methylpentan-3-yl)-1,2,4-oxadiazole.
| Compound Name | 5-methyl-3-(2-methylpentan-3-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 91277135 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 5-methyl-3-(2-methylpentan-3-yl)-1,2,4-oxadiazole |
| SMILES | CCC(c1noc(C)n1)C(C)C |
| InChI | InChI=1S/C9H16N2O/c1-5-8(6(2)3)9-10-7(4)12-11-9/h6,8H,5H2,1-4H3 |
| InChIKey | GANJCSLCOSIXMH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |