C5H8N2O2 — CID 75525832
1-(5-methyl-1,2,4-oxadiazol-3-yl)ethanol (PubChem CID 75525832) has the molecular formula C5H8N2O2 and a molecular weight of 128.13 g/mol. Its IUPAC name is 1-(5-methyl-1,2,4-oxadiazol-3-yl)ethanol.
| Compound Name | 1-(5-methyl-1,2,4-oxadiazol-3-yl)ethanol |
|---|---|
| PubChem CID | 75525832 |
| Molecular Formula | C5H8N2O2 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | 1-(5-methyl-1,2,4-oxadiazol-3-yl)ethanol |
| SMILES | Cc1nc(C(C)O)no1 |
| InChI | InChI=1S/C5H8N2O2/c1-3(8)5-6-4(2)9-7-5/h3,8H,1-2H3 |
| InChIKey | ZKMLNFVUVVWVCD-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |