About 1-[5-(3-methylfuran-2-yl)-1,2,4-oxadiazol-3-yl]ethanol
1-[5-(3-methylfuran-2-yl)-1,2,4-oxadiazol-3-yl]ethanol (PubChem CID 102660767) has the molecular formula C9H10N2O3
and a molecular weight of 194.19 g/mol. Its IUPAC name is 1-[5-(3-methylfuran-2-yl)-1,2,4-oxadiazol-3-yl]ethanol.
Molecular Properties
| Compound Name | 1-[5-(3-methylfuran-2-yl)-1,2,4-oxadiazol-3-yl]ethanol |
| PubChem CID | 102660767 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 1-[5-(3-methylfuran-2-yl)-1,2,4-oxadiazol-3-yl]ethanol |
| SMILES | Cc1ccoc1-c1nc(C(C)O)no1 |
| InChI | InChI=1S/C9H10N2O3/c1-5-3-4-13-7(5)9-10-8(6(2)12)11-14-9/h3-4,6,12H,1-2H3 |
| InChIKey | VFLQSXAZQXDISI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[5-(3-methylfuran-2-yl)-1,2,4-oxadiazol-3-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(3-methylfuran-2-yl)-1,2,4-oxadiazol-3-yl]ethanol?
The IUPAC name of 1-[5-(3-methylfuran-2-yl)-1,2,4-oxadiazol-3-yl]ethanol (CID 102660767) is 1-[5-(3-methylfuran-2-yl)-1,2,4-oxadiazol-3-yl]ethanol.
What is the SMILES notation for 1-[5-(3-methylfuran-2-yl)-1,2,4-oxadiazol-3-yl]ethanol?
The canonical SMILES for 1-[5-(3-methylfuran-2-yl)-1,2,4-oxadiazol-3-yl]ethanol is Cc1ccoc1-c1nc(C(C)O)no1.
What is the InChIKey of 1-[5-(3-methylfuran-2-yl)-1,2,4-oxadiazol-3-yl]ethanol?
The InChIKey is VFLQSXAZQXDISI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O3/c1-5-3-4-13-7(5)9-10-8(6(2)12)11-14-9/h3-4,6,12H,1-2H3.
What are the key properties of 1-[5-(3-methylfuran-2-yl)-1,2,4-oxadiazol-3-yl]ethanol?
1-[5-(3-methylfuran-2-yl)-1,2,4-oxadiazol-3-yl]ethanol has a molecular weight of 194.19 g/mol, XLogP of 1.69, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(3-methylfuran-2-yl)-1,2,4-oxadiazol-3-yl]ethanol is sourced from PubChem (CID 102660767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).