C9H10N2O3 — CID 102660767
1-[5-(3-methylfuran-2-yl)-1,2,4-oxadiazol-3-yl]ethanol (PubChem CID 102660767) has the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. Its IUPAC name is 1-[5-(3-methylfuran-2-yl)-1,2,4-oxadiazol-3-yl]ethanol.
| Compound Name | 1-[5-(3-methylfuran-2-yl)-1,2,4-oxadiazol-3-yl]ethanol |
|---|---|
| PubChem CID | 102660767 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 1-[5-(3-methylfuran-2-yl)-1,2,4-oxadiazol-3-yl]ethanol |
| SMILES | Cc1ccoc1-c1nc(C(C)O)no1 |
| InChI | InChI=1S/C9H10N2O3/c1-5-3-4-13-7(5)9-10-8(6(2)12)11-14-9/h3-4,6,12H,1-2H3 |
| InChIKey | VFLQSXAZQXDISI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |