C13H24N4 — CID 123175019
4-butan-2-yl-6-(2-methylpentan-3-yl)-1,3,5-triazin-2-amine (PubChem CID 123175019) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is 4-butan-2-yl-6-(2-methylpentan-3-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-butan-2-yl-6-(2-methylpentan-3-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 123175019 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | 4-butan-2-yl-6-(2-methylpentan-3-yl)-1,3,5-triazin-2-amine |
| SMILES | CCC(C)c1nc(N)nc(C(CC)C(C)C)n1 |
| InChI | InChI=1S/C13H24N4/c1-6-9(5)11-15-12(17-13(14)16-11)10(7-2)8(3)4/h8-10H,6-7H2,1-5H3,(H2,14,15,16,17) |
| InChIKey | CNJRFVOWEVBUHU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |