C14H20ClNO — CID 143409135
3-(2-chlorophenyl)-5-methyl-1,2-oxazole;ethane (PubChem CID 143409135) has the molecular formula C14H20ClNO and a molecular weight of 253.77 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-5-methyl-1,2-oxazole;ethane.
| Compound Name | 3-(2-chlorophenyl)-5-methyl-1,2-oxazole;ethane |
|---|---|
| PubChem CID | 143409135 |
| Molecular Formula | C14H20ClNO |
| Molecular Weight | 253.77 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 3-(2-chlorophenyl)-5-methyl-1,2-oxazole;ethane |
| SMILES | CC.CC.Cc1cc(-c2ccccc2Cl)no1 |
| InChI | InChI=1S/C10H8ClNO.2C2H6/c1-7-6-10(12-13-7)8-4-2-3-5-9(8)11;2*1-2/h2-6H,1H3;2*1-2H3 |
| InChIKey | TUCTUZFDHODPIX-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.77 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |