C14H11ClN4O — CID 72930406
N-[[3-(2-chlorophenyl)-1,2-oxazol-5-yl]methyl]pyrimidin-2-amine (PubChem CID 72930406) has the molecular formula C14H11ClN4O and a molecular weight of 286.72 g/mol. Its IUPAC name is N-[[3-(2-chlorophenyl)-1,2-oxazol-5-yl]methyl]pyrimidin-2-amine.
| Compound Name | N-[[3-(2-chlorophenyl)-1,2-oxazol-5-yl]methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 72930406 |
| Molecular Formula | C14H11ClN4O |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | N-[[3-(2-chlorophenyl)-1,2-oxazol-5-yl]methyl]pyrimidin-2-amine |
| SMILES | Clc1ccccc1-c1cc(CNc2ncccn2)on1 |
| InChI | InChI=1S/C14H11ClN4O/c15-12-5-2-1-4-11(12)13-8-10(20-19-13)9-18-14-16-6-3-7-17-14/h1-8H,9H2,(H,16,17,18) |
| InChIKey | BOOWPDQYLDHDIG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |