C14H9ClN2S — CID 17475261
4-(2-chlorophenyl)-2-pyridin-2-yl-1,3-thiazole (PubChem CID 17475261) has the molecular formula C14H9ClN2S and a molecular weight of 272.76 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-2-pyridin-2-yl-1,3-thiazole.
| Compound Name | 4-(2-chlorophenyl)-2-pyridin-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 17475261 |
| Molecular Formula | C14H9ClN2S |
| Molecular Weight | 272.76 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 4-(2-chlorophenyl)-2-pyridin-2-yl-1,3-thiazole |
| SMILES | Clc1ccccc1-c1csc(-c2ccccn2)n1 |
| InChI | InChI=1S/C14H9ClN2S/c15-11-6-2-1-5-10(11)13-9-18-14(17-13)12-7-3-4-8-16-12/h1-9H |
| InChIKey | YYDSXWTVOVFQLO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.76 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |