C20H15N3O2S — CID 54124111
2-[4-(2-pyridin-2-yl-1,3-thiazol-4-yl)but-3-enyl]isoindole-1,3-dione (PubChem CID 54124111) has the molecular formula C20H15N3O2S and a molecular weight of 361.43 g/mol. Its IUPAC name is 2-[4-(2-pyridin-2-yl-1,3-thiazol-4-yl)but-3-enyl]isoindole-1,3-dione.
| Compound Name | 2-[4-(2-pyridin-2-yl-1,3-thiazol-4-yl)but-3-enyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 54124111 |
| Molecular Formula | C20H15N3O2S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 2-[4-(2-pyridin-2-yl-1,3-thiazol-4-yl)but-3-enyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCC=Cc1csc(-c2ccccn2)n1 |
| InChI | InChI=1S/C20H15N3O2S/c24-19-15-8-1-2-9-16(15)20(25)23(19)12-6-4-7-14-13-26-18(22-14)17-10-3-5-11-21-17/h1-5,7-11,13H,6,12H2 |
| InChIKey | NPTPZCFAQIQKCY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|