C16H15N5O2S — CID 23330882
2-[4-[(E)-4-(1,3-dioxoisoindol-2-yl)but-1-enyl]-1,3-thiazol-2-yl]guanidine (PubChem CID 23330882) has the molecular formula C16H15N5O2S and a molecular weight of 341.40 g/mol. Its IUPAC name is 2-[4-[(E)-4-(1,3-dioxoisoindol-2-yl)but-1-enyl]-1,3-thiazol-2-yl]guanidine.
| Compound Name | 2-[4-[(E)-4-(1,3-dioxoisoindol-2-yl)but-1-enyl]-1,3-thiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 23330882 |
| Molecular Formula | C16H15N5O2S |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 2-[4-[(E)-4-(1,3-dioxoisoindol-2-yl)but-1-enyl]-1,3-thiazol-2-yl]guanidine |
| SMILES | NC(N)=Nc1nc(/C=C/CCN2C(=O)c3ccccc3C2=O)cs1 |
| InChI | InChI=1S/C16H15N5O2S/c17-15(18)20-16-19-10(9-24-16)5-3-4-8-21-13(22)11-6-1-2-7-12(11)14(21)23/h1-3,5-7,9H,4,8H2,(H4,17,18,19,20)/b5-3+ |
| InChIKey | JYZDMOZYYPUWKV-HWKANZROSA-N |
| XLogP | 1.75 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|