C23H24N2O4 — CID 142133742
methyl (E)-5-[5-[4-(1,3-dioxoisoindol-2-yl)butyl]-2-pyridinyl]pent-4-enoate (PubChem CID 142133742) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is methyl (E)-5-[5-[4-(1,3-dioxoisoindol-2-yl)butyl]-2-pyridinyl]pent-4-enoate.
| Compound Name | methyl (E)-5-[5-[4-(1,3-dioxoisoindol-2-yl)butyl]-2-pyridinyl]pent-4-enoate |
|---|---|
| PubChem CID | 142133742 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | methyl (E)-5-[5-[4-(1,3-dioxoisoindol-2-yl)butyl]-2-pyridinyl]pent-4-enoate |
| SMILES | COC(=O)CC/C=C/c1ccc(CCCCN2C(=O)c3ccccc3C2=O)cn1 |
| InChI | InChI=1S/C23H24N2O4/c1-29-21(26)12-5-2-9-18-14-13-17(16-24-18)8-6-7-15-25-22(27)19-10-3-4-11-20(19)23(25)28/h2-4,9-11,13-14,16H,5-8,12,15H2,1H3/b9-2+ |
| InChIKey | WSCIAUMOCSTJQJ-XNWCZRBMSA-N |
| XLogP | 3.67 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|