C16H20N5O4+ — CID 147032340
[5-[2-[1-amino-3-(1,3-dioxoisoindol-2-yl)propylidene]hydrazinyl]-5-oxopentanoyl]azanium (PubChem CID 147032340) has the molecular formula C16H20N5O4+ and a molecular weight of 346.37 g/mol. Its IUPAC name is [5-[2-[1-amino-3-(1,3-dioxoisoindol-2-yl)propylidene]hydrazinyl]-5-oxopentanoyl]azanium.
| Compound Name | [5-[2-[1-amino-3-(1,3-dioxoisoindol-2-yl)propylidene]hydrazinyl]-5-oxopentanoyl]azanium |
|---|---|
| PubChem CID | 147032340 |
| Molecular Formula | C16H20N5O4+ |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | [5-[2-[1-amino-3-(1,3-dioxoisoindol-2-yl)propylidene]hydrazinyl]-5-oxopentanoyl]azanium |
| SMILES | NC(CCN1C(=O)c2ccccc2C1=O)=NNC(=O)CCCC([NH3+])=O |
| InChI | InChI=1S/C16H19N5O4/c17-12(19-20-14(23)7-3-6-13(18)22)8-9-21-15(24)10-4-1-2-5-11(10)16(21)25/h1-2,4-5H,3,6-9H2,(H2,17,19)(H2,18,22)(H,20,23)/p+1 |
| InChIKey | AXVOWKXBVSYQCL-UHFFFAOYSA-O |
| XLogP | -1.00 |
| TPSA | 149.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|