C24H19N3O3 — CID 9095307
N-(benzhydrylideneamino)-3-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 9095307) has the molecular formula C24H19N3O3 and a molecular weight of 397.43 g/mol. Its IUPAC name is N-(benzhydrylideneamino)-3-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-(benzhydrylideneamino)-3-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 9095307 |
| Molecular Formula | C24H19N3O3 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | N-(benzhydrylideneamino)-3-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | O=C(CCN1C(=O)c2ccccc2C1=O)NN=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H19N3O3/c28-21(15-16-27-23(29)19-13-7-8-14-20(19)24(27)30)25-26-22(17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-14H,15-16H2,(H,25,28) |
| InChIKey | IZBCUHOOLRKLFZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|