C18H16Cl2N4O2 — CID 175762428
2-[(E)-6-(2-amino-4,6-dichloropyrimidin-5-yl)hex-4-enyl]isoindole-1,3-dione (PubChem CID 175762428) has the molecular formula C18H16Cl2N4O2 and a molecular weight of 391.26 g/mol. Its IUPAC name is 2-[(E)-6-(2-amino-4,6-dichloropyrimidin-5-yl)hex-4-enyl]isoindole-1,3-dione.
| Compound Name | 2-[(E)-6-(2-amino-4,6-dichloropyrimidin-5-yl)hex-4-enyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 175762428 |
| Molecular Formula | C18H16Cl2N4O2 |
| Molecular Weight | 391.26 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 2-[(E)-6-(2-amino-4,6-dichloropyrimidin-5-yl)hex-4-enyl]isoindole-1,3-dione |
| SMILES | Nc1nc(Cl)c(C/C=C/CCCN2C(=O)c3ccccc3C2=O)c(Cl)n1 |
| InChI | InChI=1S/C18H16Cl2N4O2/c19-14-13(15(20)23-18(21)22-14)9-3-1-2-6-10-24-16(25)11-7-4-5-8-12(11)17(24)26/h1,3-5,7-8H,2,6,9-10H2,(H2,21,22,23)/b3-1+ |
| InChIKey | CYGDLZJZSBYBKT-HNQUOIGGSA-N |
| XLogP | 3.54 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.26 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|