C18H19N3O2 — CID 102593459
2-[(E)-5-(3,5-dimethylpyrazol-1-yl)pent-4-enyl]isoindole-1,3-dione (PubChem CID 102593459) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-[(E)-5-(3,5-dimethylpyrazol-1-yl)pent-4-enyl]isoindole-1,3-dione.
| Compound Name | 2-[(E)-5-(3,5-dimethylpyrazol-1-yl)pent-4-enyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 102593459 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-[(E)-5-(3,5-dimethylpyrazol-1-yl)pent-4-enyl]isoindole-1,3-dione |
| SMILES | Cc1cc(C)n(/C=C/CCCN2C(=O)c3ccccc3C2=O)n1 |
| InChI | InChI=1S/C18H19N3O2/c1-13-12-14(2)21(19-13)11-7-3-6-10-20-17(22)15-8-4-5-9-16(15)18(20)23/h4-5,7-9,11-12H,3,6,10H2,1-2H3/b11-7+ |
| InChIKey | WWDFXRMBJIFXDV-YRNVUSSQSA-N |
| XLogP | 3.05 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|