C14H11Cl2N3O2 — CID 2779187
2-[3-(4,5-dichloroimidazol-1-yl)propyl]isoindole-1,3-dione (PubChem CID 2779187) has the molecular formula C14H11Cl2N3O2 and a molecular weight of 324.17 g/mol. Its IUPAC name is 2-[3-(4,5-dichloroimidazol-1-yl)propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(4,5-dichloroimidazol-1-yl)propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 2779187 |
| Molecular Formula | C14H11Cl2N3O2 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 2-[3-(4,5-dichloroimidazol-1-yl)propyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCn1cnc(Cl)c1Cl |
| InChI | InChI=1S/C14H11Cl2N3O2/c15-11-12(16)18(8-17-11)6-3-7-19-13(20)9-4-1-2-5-10(9)14(19)21/h1-2,4-5,8H,3,6-7H2 |
| InChIKey | IZVHFKIICYYCJU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|