C18H17N5O2 — CID 11530108
2-[4-(6-methylpurin-9-yl)butyl]isoindole-1,3-dione (PubChem CID 11530108) has the molecular formula C18H17N5O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is 2-[4-(6-methylpurin-9-yl)butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-(6-methylpurin-9-yl)butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11530108 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 2-[4-(6-methylpurin-9-yl)butyl]isoindole-1,3-dione |
| SMILES | Cc1ncnc2c1ncn2CCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H17N5O2/c1-12-15-16(20-10-19-12)22(11-21-15)8-4-5-9-23-17(24)13-6-2-3-7-14(13)18(23)25/h2-3,6-7,10-11H,4-5,8-9H2,1H3 |
| InChIKey | ITILODMLJWZBRB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|