C23H17N3O2 — CID 66941848
5-[6-[(1,3-dioxoisoindol-2-yl)methyl]quinolin-2-yl]pent-4-enenitrile (PubChem CID 66941848) has the molecular formula C23H17N3O2 and a molecular weight of 367.41 g/mol. Its IUPAC name is 5-[6-[(1,3-dioxoisoindol-2-yl)methyl]quinolin-2-yl]pent-4-enenitrile.
| Compound Name | 5-[6-[(1,3-dioxoisoindol-2-yl)methyl]quinolin-2-yl]pent-4-enenitrile |
|---|---|
| PubChem CID | 66941848 |
| Molecular Formula | C23H17N3O2 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 5-[6-[(1,3-dioxoisoindol-2-yl)methyl]quinolin-2-yl]pent-4-enenitrile |
| SMILES | N#CCCC=Cc1ccc2cc(CN3C(=O)c4ccccc4C3=O)ccc2n1 |
| InChI | InChI=1S/C23H17N3O2/c24-13-5-1-2-6-18-11-10-17-14-16(9-12-21(17)25-18)15-26-22(27)19-7-3-4-8-20(19)23(26)28/h2-4,6-12,14H,1,5,15H2 |
| InChIKey | BGFHFKUCVBLAQE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 74.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|