C20H15N3O3 — CID 155705031
N-[7-[(1,3-dioxoisoindol-2-yl)methyl]quinolin-2-yl]acetamide (PubChem CID 155705031) has the molecular formula C20H15N3O3 and a molecular weight of 345.36 g/mol. Its IUPAC name is N-[7-[(1,3-dioxoisoindol-2-yl)methyl]quinolin-2-yl]acetamide.
| Compound Name | N-[7-[(1,3-dioxoisoindol-2-yl)methyl]quinolin-2-yl]acetamide |
|---|---|
| PubChem CID | 155705031 |
| Molecular Formula | C20H15N3O3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-[7-[(1,3-dioxoisoindol-2-yl)methyl]quinolin-2-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2ccc(CN3C(=O)c4ccccc4C3=O)cc2n1 |
| InChI | InChI=1S/C20H15N3O3/c1-12(24)21-18-9-8-14-7-6-13(10-17(14)22-18)11-23-19(25)15-4-2-3-5-16(15)20(23)26/h2-10H,11H2,1H3,(H,21,22,24) |
| InChIKey | NKACOTLKBYAIFM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|