C19H16BrNO3 — CID 58092112
2-[[3-bromo-4-(3-oxobutyl)phenyl]methyl]isoindole-1,3-dione (PubChem CID 58092112) has the molecular formula C19H16BrNO3 and a molecular weight of 386.25 g/mol. Its IUPAC name is 2-[[3-bromo-4-(3-oxobutyl)phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[3-bromo-4-(3-oxobutyl)phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58092112 |
| Molecular Formula | C19H16BrNO3 |
| Molecular Weight | 386.25 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 2-[[3-bromo-4-(3-oxobutyl)phenyl]methyl]isoindole-1,3-dione |
| SMILES | CC(=O)CCc1ccc(CN2C(=O)c3ccccc3C2=O)cc1Br |
| InChI | InChI=1S/C19H16BrNO3/c1-12(22)6-8-14-9-7-13(10-17(14)20)11-21-18(23)15-4-2-3-5-16(15)19(21)24/h2-5,7,9-10H,6,8,11H2,1H3 |
| InChIKey | NWNRDWBABGKNAZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.25 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|