C20H16N4O3 — CID 60519196
4-[(1,3-dioxoisoindol-2-yl)methyl]-N-(5-methyl-1H-pyrazol-3-yl)benzamide (PubChem CID 60519196) has the molecular formula C20H16N4O3 and a molecular weight of 360.37 g/mol. Its IUPAC name is 4-[(1,3-dioxoisoindol-2-yl)methyl]-N-(5-methyl-1H-pyrazol-3-yl)benzamide.
| Compound Name | 4-[(1,3-dioxoisoindol-2-yl)methyl]-N-(5-methyl-1H-pyrazol-3-yl)benzamide |
|---|---|
| PubChem CID | 60519196 |
| Molecular Formula | C20H16N4O3 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 4-[(1,3-dioxoisoindol-2-yl)methyl]-N-(5-methyl-1H-pyrazol-3-yl)benzamide |
| SMILES | Cc1cc(NC(=O)c2ccc(CN3C(=O)c4ccccc4C3=O)cc2)n[nH]1 |
| InChI | InChI=1S/C20H16N4O3/c1-12-10-17(23-22-12)21-18(25)14-8-6-13(7-9-14)11-24-19(26)15-4-2-3-5-16(15)20(24)27/h2-10H,11H2,1H3,(H2,21,22,23,25) |
| InChIKey | RLIXNSYPNHAOJY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|