C25H19N5O3 — CID 36861383
4-[(1,3-dioxoisoindol-2-yl)methyl]-N-[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]benzamide (PubChem CID 36861383) has the molecular formula C25H19N5O3 and a molecular weight of 437.46 g/mol. Its IUPAC name is 4-[(1,3-dioxoisoindol-2-yl)methyl]-N-[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]benzamide.
| Compound Name | 4-[(1,3-dioxoisoindol-2-yl)methyl]-N-[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]benzamide |
|---|---|
| PubChem CID | 36861383 |
| Molecular Formula | C25H19N5O3 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 4-[(1,3-dioxoisoindol-2-yl)methyl]-N-[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]benzamide |
| SMILES | Cc1ccc(-c2nc(NC(=O)c3ccc(CN4C(=O)c5ccccc5C4=O)cc3)n[nH]2)cc1 |
| InChI | InChI=1S/C25H19N5O3/c1-15-6-10-17(11-7-15)21-26-25(29-28-21)27-22(31)18-12-8-16(9-13-18)14-30-23(32)19-4-2-3-5-20(19)24(30)33/h2-13H,14H2,1H3,(H2,26,27,28,29,31) |
| InChIKey | GBIMOUHBVCTEME-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|