C24H16N4O3S — CID 55985027
4-[(1,3-dioxoisoindol-2-yl)methyl]-N-[4-(thiadiazol-4-yl)phenyl]benzamide (PubChem CID 55985027) has the molecular formula C24H16N4O3S and a molecular weight of 440.48 g/mol. Its IUPAC name is 4-[(1,3-dioxoisoindol-2-yl)methyl]-N-[4-(thiadiazol-4-yl)phenyl]benzamide.
| Compound Name | 4-[(1,3-dioxoisoindol-2-yl)methyl]-N-[4-(thiadiazol-4-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 55985027 |
| Molecular Formula | C24H16N4O3S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 4-[(1,3-dioxoisoindol-2-yl)methyl]-N-[4-(thiadiazol-4-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(-c2csnn2)cc1)c1ccc(CN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C24H16N4O3S/c29-22(25-18-11-9-16(10-12-18)21-14-32-27-26-21)17-7-5-15(6-8-17)13-28-23(30)19-3-1-2-4-20(19)24(28)31/h1-12,14H,13H2,(H,25,29) |
| InChIKey | UCEGVTAISYHISQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|